C17H11N3O2 — CID 23225844
N-(3-ethynylphenyl)-3H-dioxolo[3,4-g]quinazolin-8-amine (PubChem CID 23225844) has the molecular formula C17H11N3O2 and a molecular weight of 289.29 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-3H-dioxolo[3,4-g]quinazolin-8-amine.
| Compound Name | N-(3-ethynylphenyl)-3H-dioxolo[3,4-g]quinazolin-8-amine |
|---|---|
| PubChem CID | 23225844 |
| Molecular Formula | C17H11N3O2 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-(3-ethynylphenyl)-3H-dioxolo[3,4-g]quinazolin-8-amine |
| SMILES | C#Cc1cccc(Nc2ncnc3cc4c(cc23)OOC4)c1 |
| InChI | InChI=1S/C17H11N3O2/c1-2-11-4-3-5-13(6-11)20-17-14-8-16-12(9-21-22-16)7-15(14)18-10-19-17/h1,3-8,10H,9H2,(H,18,19,20) |
| InChIKey | SYBVRFROKMOUCW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|