C15H11N3O3 — CID 19963156
4-([1,3]dioxolo[4,5-g]quinazolin-8-ylamino)phenol (PubChem CID 19963156) has the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. Its IUPAC name is 4-([1,3]dioxolo[4,5-g]quinazolin-8-ylamino)phenol.
| Compound Name | 4-([1,3]dioxolo[4,5-g]quinazolin-8-ylamino)phenol |
|---|---|
| PubChem CID | 19963156 |
| Molecular Formula | C15H11N3O3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 4-([1,3]dioxolo[4,5-g]quinazolin-8-ylamino)phenol |
| SMILES | Oc1ccc(Nc2ncnc3cc4c(cc23)OCO4)cc1 |
| InChI | InChI=1S/C15H11N3O3/c19-10-3-1-9(2-4-10)18-15-11-5-13-14(21-8-20-13)6-12(11)16-7-17-15/h1-7,19H,8H2,(H,16,17,18) |
| InChIKey | CRZPVSMPJCPEPP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|