C18H15N5O4 — CID 22542016
4-N,6-N-bis(1,3-benzodioxol-5-yl)pyrimidine-4,5,6-triamine (PubChem CID 22542016) has the molecular formula C18H15N5O4 and a molecular weight of 365.35 g/mol. Its IUPAC name is 4-N,6-N-bis(1,3-benzodioxol-5-yl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N,6-N-bis(1,3-benzodioxol-5-yl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22542016 |
| Molecular Formula | C18H15N5O4 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 4-N,6-N-bis(1,3-benzodioxol-5-yl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(Nc2ccc3c(c2)OCO3)ncnc1Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H15N5O4/c19-16-17(22-10-1-3-12-14(5-10)26-8-24-12)20-7-21-18(16)23-11-2-4-13-15(6-11)27-9-25-13/h1-7H,8-9,19H2,(H2,20,21,22,23) |
| InChIKey | CKYXAPKKYALEDY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |