C24H21N5O2 — CID 22542150
4-N-benzhydryl-6-N-(1,3-benzodioxol-5-yl)pyrimidine-4,5,6-triamine (PubChem CID 22542150) has the molecular formula C24H21N5O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is 4-N-benzhydryl-6-N-(1,3-benzodioxol-5-yl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-benzhydryl-6-N-(1,3-benzodioxol-5-yl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22542150 |
| Molecular Formula | C24H21N5O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 4-N-benzhydryl-6-N-(1,3-benzodioxol-5-yl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(Nc2ccc3c(c2)OCO3)ncnc1NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H21N5O2/c25-21-23(28-18-11-12-19-20(13-18)31-15-30-19)26-14-27-24(21)29-22(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14,22H,15,25H2,(H2,26,27,28,29) |
| InChIKey | JRCCIPFOXUTUNK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |