C25H25N5 — CID 22541010
4-N-benzhydryl-6-N-(3,5-dimethylphenyl)pyrimidine-4,5,6-triamine (PubChem CID 22541010) has the molecular formula C25H25N5 and a molecular weight of 395.51 g/mol. Its IUPAC name is 4-N-benzhydryl-6-N-(3,5-dimethylphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-benzhydryl-6-N-(3,5-dimethylphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22541010 |
| Molecular Formula | C25H25N5 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 4-N-benzhydryl-6-N-(3,5-dimethylphenyl)pyrimidine-4,5,6-triamine |
| SMILES | Cc1cc(C)cc(Nc2ncnc(NC(c3ccccc3)c3ccccc3)c2N)c1 |
| InChI | InChI=1S/C25H25N5/c1-17-13-18(2)15-21(14-17)29-24-22(26)25(28-16-27-24)30-23(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-16,23H,26H2,1-2H3,(H2,27,28,29,30) |
| InChIKey | JQKSBBRGCXGOLD-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |