C23H19F2N5 — CID 19150226
4-N-benzhydryl-6-N-(2,4-difluorophenyl)pyrimidine-4,5,6-triamine (PubChem CID 19150226) has the molecular formula C23H19F2N5 and a molecular weight of 403.44 g/mol. Its IUPAC name is 4-N-benzhydryl-6-N-(2,4-difluorophenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-benzhydryl-6-N-(2,4-difluorophenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19150226 |
| Molecular Formula | C23H19F2N5 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 4-N-benzhydryl-6-N-(2,4-difluorophenyl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(Nc2ccc(F)cc2F)ncnc1NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H19F2N5/c24-17-11-12-19(18(25)13-17)29-22-20(26)23(28-14-27-22)30-21(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,21H,26H2,(H2,27,28,29,30) |
| InChIKey | HYDXIRWZBQPUBD-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |