C23H20IN5 — CID 19148896
4-N-benzhydryl-6-N-(4-iodophenyl)pyrimidine-4,5,6-triamine (PubChem CID 19148896) has the molecular formula C23H20IN5 and a molecular weight of 493.35 g/mol. Its IUPAC name is 4-N-benzhydryl-6-N-(4-iodophenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-benzhydryl-6-N-(4-iodophenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19148896 |
| Molecular Formula | C23H20IN5 |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 4-N-benzhydryl-6-N-(4-iodophenyl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(Nc2ccc(I)cc2)ncnc1NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20IN5/c24-18-11-13-19(14-12-18)28-22-20(25)23(27-15-26-22)29-21(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-15,21H,25H2,(H2,26,27,28,29) |
| InChIKey | DGNLUYVNZMKRNW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|