C22H17Cl2N5O — CID 22546939
4-N-(3,4-dichlorophenyl)-6-N-(4-phenoxyphenyl)pyrimidine-4,5,6-triamine (PubChem CID 22546939) has the molecular formula C22H17Cl2N5O and a molecular weight of 438.32 g/mol. Its IUPAC name is 4-N-(3,4-dichlorophenyl)-6-N-(4-phenoxyphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(3,4-dichlorophenyl)-6-N-(4-phenoxyphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22546939 |
| Molecular Formula | C22H17Cl2N5O |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 4-N-(3,4-dichlorophenyl)-6-N-(4-phenoxyphenyl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(Nc2ccc(Oc3ccccc3)cc2)ncnc1Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H17Cl2N5O/c23-18-11-8-15(12-19(18)24)29-22-20(25)21(26-13-27-22)28-14-6-9-17(10-7-14)30-16-4-2-1-3-5-16/h1-13H,25H2,(H2,26,27,28,29) |
| InChIKey | SPFFXCKQVOLUIQ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |