C18H15Cl2N5O2 — CID 22546860
methyl 4-[[5-amino-6-(3,4-dichloroanilino)pyrimidin-4-yl]amino]benzoate (PubChem CID 22546860) has the molecular formula C18H15Cl2N5O2 and a molecular weight of 404.26 g/mol. Its IUPAC name is methyl 4-[[5-amino-6-(3,4-dichloroanilino)pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 4-[[5-amino-6-(3,4-dichloroanilino)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22546860 |
| Molecular Formula | C18H15Cl2N5O2 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | methyl 4-[[5-amino-6-(3,4-dichloroanilino)pyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2ncnc(Nc3ccc(Cl)c(Cl)c3)c2N)cc1 |
| InChI | InChI=1S/C18H15Cl2N5O2/c1-27-18(26)10-2-4-11(5-3-10)24-16-15(21)17(23-9-22-16)25-12-6-7-13(19)14(20)8-12/h2-9H,21H2,1H3,(H2,22,23,24,25) |
| InChIKey | GKHFTDIDZLPPKD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |