C17H21N5O2 — CID 19149466
methyl 4-[[5-amino-6-(cyclopentylamino)pyrimidin-4-yl]amino]benzoate (PubChem CID 19149466) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is methyl 4-[[5-amino-6-(cyclopentylamino)pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 4-[[5-amino-6-(cyclopentylamino)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 19149466 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | methyl 4-[[5-amino-6-(cyclopentylamino)pyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2ncnc(NC3CCCC3)c2N)cc1 |
| InChI | InChI=1S/C17H21N5O2/c1-24-17(23)11-6-8-13(9-7-11)22-16-14(18)15(19-10-20-16)21-12-4-2-3-5-12/h6-10,12H,2-5,18H2,1H3,(H2,19,20,21,22) |
| InChIKey | FVYWBBKCHCSWRN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |