C17H23N5O — CID 19149265
4-N-cyclopentyl-6-N-(4-ethoxyphenyl)pyrimidine-4,5,6-triamine (PubChem CID 19149265) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is 4-N-cyclopentyl-6-N-(4-ethoxyphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-cyclopentyl-6-N-(4-ethoxyphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19149265 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 4-N-cyclopentyl-6-N-(4-ethoxyphenyl)pyrimidine-4,5,6-triamine |
| SMILES | CCOc1ccc(Nc2ncnc(NC3CCCC3)c2N)cc1 |
| InChI | InChI=1S/C17H23N5O/c1-2-23-14-9-7-13(8-10-14)22-17-15(18)16(19-11-20-17)21-12-5-3-4-6-12/h7-12H,2-6,18H2,1H3,(H2,19,20,21,22) |
| InChIKey | QUSVWAIELWEKAC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |