C18H23N5O2 — CID 19154101
4-[[5-amino-6-(cycloheptylamino)pyrimidin-4-yl]amino]benzoic acid (PubChem CID 19154101) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 4-[[5-amino-6-(cycloheptylamino)pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[5-amino-6-(cycloheptylamino)pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 19154101 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 4-[[5-amino-6-(cycloheptylamino)pyrimidin-4-yl]amino]benzoic acid |
| SMILES | Nc1c(Nc2ccc(C(=O)O)cc2)ncnc1NC1CCCCCC1 |
| InChI | InChI=1S/C18H23N5O2/c19-15-16(22-13-5-3-1-2-4-6-13)20-11-21-17(15)23-14-9-7-12(8-10-14)18(24)25/h7-11,13H,1-6,19H2,(H,24,25)(H2,20,21,22,23) |
| InChIKey | YBJUTHJHMHENNI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |