C17H16N6O2 — CID 19144421
4-[[5-amino-6-(2-phenylhydrazinyl)pyrimidin-4-yl]amino]benzoic acid (PubChem CID 19144421) has the molecular formula C17H16N6O2 and a molecular weight of 336.36 g/mol. Its IUPAC name is 4-[[5-amino-6-(2-phenylhydrazinyl)pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[5-amino-6-(2-phenylhydrazinyl)pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 19144421 |
| Molecular Formula | C17H16N6O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 4-[[5-amino-6-(2-phenylhydrazinyl)pyrimidin-4-yl]amino]benzoic acid |
| SMILES | Nc1c(NNc2ccccc2)ncnc1Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H16N6O2/c18-14-15(21-12-8-6-11(7-9-12)17(24)25)19-10-20-16(14)23-22-13-4-2-1-3-5-13/h1-10,22H,18H2,(H,24,25)(H2,19,20,21,23) |
| InChIKey | RZNQKEIEGNLNDL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|