C17H18N6O — CID 19144334
4-N-(4-methoxyphenyl)-6-(2-phenylhydrazinyl)pyrimidine-4,5-diamine (PubChem CID 19144334) has the molecular formula C17H18N6O and a molecular weight of 322.37 g/mol. Its IUPAC name is 4-N-(4-methoxyphenyl)-6-(2-phenylhydrazinyl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(4-methoxyphenyl)-6-(2-phenylhydrazinyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19144334 |
| Molecular Formula | C17H18N6O |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 4-N-(4-methoxyphenyl)-6-(2-phenylhydrazinyl)pyrimidine-4,5-diamine |
| SMILES | COc1ccc(Nc2ncnc(NNc3ccccc3)c2N)cc1 |
| InChI | InChI=1S/C17H18N6O/c1-24-14-9-7-12(8-10-14)21-16-15(18)17(20-11-19-16)23-22-13-5-3-2-4-6-13/h2-11,22H,18H2,1H3,(H2,19,20,21,23) |
| InChIKey | ULEHJWFQJFTOBU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|