C18H20N6O2 — CID 19142678
4-N-(2,5-dimethoxyphenyl)-6-(2-phenylhydrazinyl)pyrimidine-4,5-diamine (PubChem CID 19142678) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 4-N-(2,5-dimethoxyphenyl)-6-(2-phenylhydrazinyl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(2,5-dimethoxyphenyl)-6-(2-phenylhydrazinyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19142678 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 4-N-(2,5-dimethoxyphenyl)-6-(2-phenylhydrazinyl)pyrimidine-4,5-diamine |
| SMILES | COc1ccc(OC)c(Nc2ncnc(NNc3ccccc3)c2N)c1 |
| InChI | InChI=1S/C18H20N6O2/c1-25-13-8-9-15(26-2)14(10-13)22-17-16(19)18(21-11-20-17)24-23-12-6-4-3-5-7-12/h3-11,23H,19H2,1-2H3,(H2,20,21,22,24) |
| InChIKey | UXTAURGASFOPBP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|