C20H23N5O4 — CID 19142820
4-N,6-N-bis(2,4-dimethoxyphenyl)pyrimidine-4,5,6-triamine (PubChem CID 19142820) has the molecular formula C20H23N5O4 and a molecular weight of 397.44 g/mol. Its IUPAC name is 4-N,6-N-bis(2,4-dimethoxyphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N,6-N-bis(2,4-dimethoxyphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19142820 |
| Molecular Formula | C20H23N5O4 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 4-N,6-N-bis(2,4-dimethoxyphenyl)pyrimidine-4,5,6-triamine |
| SMILES | COc1ccc(Nc2ncnc(Nc3ccc(OC)cc3OC)c2N)c(OC)c1 |
| InChI | InChI=1S/C20H23N5O4/c1-26-12-5-7-14(16(9-12)28-3)24-19-18(21)20(23-11-22-19)25-15-8-6-13(27-2)10-17(15)29-4/h5-11H,21H2,1-4H3,(H2,22,23,24,25) |
| InChIKey | IRUNSGKPIQMEDA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |