C20H23N5O2 — CID 19142840
6-N-(2,4-dimethoxyphenyl)-4-N-(1-phenylethyl)pyrimidine-4,5,6-triamine (PubChem CID 19142840) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 6-N-(2,4-dimethoxyphenyl)-4-N-(1-phenylethyl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-(2,4-dimethoxyphenyl)-4-N-(1-phenylethyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19142840 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 6-N-(2,4-dimethoxyphenyl)-4-N-(1-phenylethyl)pyrimidine-4,5,6-triamine |
| SMILES | COc1ccc(Nc2ncnc(NC(C)c3ccccc3)c2N)c(OC)c1 |
| InChI | InChI=1S/C20H23N5O2/c1-13(14-7-5-4-6-8-14)24-19-18(21)20(23-12-22-19)25-16-10-9-15(26-2)11-17(16)27-3/h4-13H,21H2,1-3H3,(H2,22,23,24,25) |
| InChIKey | OQUZQRRMDBGYGK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |