C14H17N3O2 — CID 66280389
2-N-(2,4-dimethoxyphenyl)-5-methylpyridine-2,3-diamine (PubChem CID 66280389) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-N-(2,4-dimethoxyphenyl)-5-methylpyridine-2,3-diamine.
| Compound Name | 2-N-(2,4-dimethoxyphenyl)-5-methylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 66280389 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 2-N-(2,4-dimethoxyphenyl)-5-methylpyridine-2,3-diamine |
| SMILES | COc1ccc(Nc2ncc(C)cc2N)c(OC)c1 |
| InChI | InChI=1S/C14H17N3O2/c1-9-6-11(15)14(16-8-9)17-12-5-4-10(18-2)7-13(12)19-3/h4-8H,15H2,1-3H3,(H,16,17) |
| InChIKey | MSHIGLGKKYVYAA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |