C13H12BrClN2O2 — CID 114836602
3-bromo-5-chloro-N-(2,4-dimethoxyphenyl)pyridin-2-amine (PubChem CID 114836602) has the molecular formula C13H12BrClN2O2 and a molecular weight of 343.61 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-(2,4-dimethoxyphenyl)pyridin-2-amine.
| Compound Name | 3-bromo-5-chloro-N-(2,4-dimethoxyphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 114836602 |
| Molecular Formula | C13H12BrClN2O2 |
| Molecular Weight | 343.61 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | 3-bromo-5-chloro-N-(2,4-dimethoxyphenyl)pyridin-2-amine |
| SMILES | COc1ccc(Nc2ncc(Cl)cc2Br)c(OC)c1 |
| InChI | InChI=1S/C13H12BrClN2O2/c1-18-9-3-4-11(12(6-9)19-2)17-13-10(14)5-8(15)7-16-13/h3-7H,1-2H3,(H,16,17) |
| InChIKey | AYVBPXSUTPVUGS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.61 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |