C15H18ClN3O2 — CID 63734235
6-chloro-N-(2,4-dimethoxyphenyl)-5-propan-2-ylpyrimidin-4-amine (PubChem CID 63734235) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is 6-chloro-N-(2,4-dimethoxyphenyl)-5-propan-2-ylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-(2,4-dimethoxyphenyl)-5-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 63734235 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 6-chloro-N-(2,4-dimethoxyphenyl)-5-propan-2-ylpyrimidin-4-amine |
| SMILES | COc1ccc(Nc2ncnc(Cl)c2C(C)C)c(OC)c1 |
| InChI | InChI=1S/C15H18ClN3O2/c1-9(2)13-14(16)17-8-18-15(13)19-11-6-5-10(20-3)7-12(11)21-4/h5-9H,1-4H3,(H,17,18,19) |
| InChIKey | KQKCGXUFLLIHDE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |