C21H25N7O — CID 19138906
4-[4-(4-methoxyphenyl)piperazin-1-yl]-6-(2-phenylhydrazinyl)pyrimidin-5-amine (PubChem CID 19138906) has the molecular formula C21H25N7O and a molecular weight of 391.48 g/mol. Its IUPAC name is 4-[4-(4-methoxyphenyl)piperazin-1-yl]-6-(2-phenylhydrazinyl)pyrimidin-5-amine.
| Compound Name | 4-[4-(4-methoxyphenyl)piperazin-1-yl]-6-(2-phenylhydrazinyl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 19138906 |
| Molecular Formula | C21H25N7O |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 4-[4-(4-methoxyphenyl)piperazin-1-yl]-6-(2-phenylhydrazinyl)pyrimidin-5-amine |
| SMILES | COc1ccc(N2CCN(c3ncnc(NNc4ccccc4)c3N)CC2)cc1 |
| InChI | InChI=1S/C21H25N7O/c1-29-18-9-7-17(8-10-18)27-11-13-28(14-12-27)21-19(22)20(23-15-24-21)26-25-16-5-3-2-4-6-16/h2-10,15,25H,11-14,22H2,1H3,(H,23,24,26) |
| InChIKey | TWUZXOQXQMOPQY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|