C21H22Cl2N6O — CID 22544913
4-N-(3,5-dichlorophenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidine-4,5-diamine (PubChem CID 22544913) has the molecular formula C21H22Cl2N6O and a molecular weight of 445.35 g/mol. Its IUPAC name is 4-N-(3,5-dichlorophenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidine-4,5-diamine.
| Compound Name | 4-N-(3,5-dichlorophenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22544913 |
| Molecular Formula | C21H22Cl2N6O |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 4-N-(3,5-dichlorophenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidine-4,5-diamine |
| SMILES | COc1ccc(N2CCN(c3ncnc(Nc4cc(Cl)cc(Cl)c4)c3N)CC2)cc1 |
| InChI | InChI=1S/C21H22Cl2N6O/c1-30-18-4-2-17(3-5-18)28-6-8-29(9-7-28)21-19(24)20(25-13-26-21)27-16-11-14(22)10-15(23)12-16/h2-5,10-13H,6-9,24H2,1H3,(H,25,26,27) |
| InChIKey | JQPUFSVZSYBQKA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|