C20H23N7O — CID 19138926
6-[4-(4-methoxyphenyl)piperazin-1-yl]-4-N-pyridin-2-ylpyrimidine-4,5-diamine (PubChem CID 19138926) has the molecular formula C20H23N7O and a molecular weight of 377.45 g/mol. Its IUPAC name is 6-[4-(4-methoxyphenyl)piperazin-1-yl]-4-N-pyridin-2-ylpyrimidine-4,5-diamine.
| Compound Name | 6-[4-(4-methoxyphenyl)piperazin-1-yl]-4-N-pyridin-2-ylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19138926 |
| Molecular Formula | C20H23N7O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 6-[4-(4-methoxyphenyl)piperazin-1-yl]-4-N-pyridin-2-ylpyrimidine-4,5-diamine |
| SMILES | COc1ccc(N2CCN(c3ncnc(Nc4ccccn4)c3N)CC2)cc1 |
| InChI | InChI=1S/C20H23N7O/c1-28-16-7-5-15(6-8-16)26-10-12-27(13-11-26)20-18(21)19(23-14-24-20)25-17-4-2-3-9-22-17/h2-9,14H,10-13,21H2,1H3,(H,22,23,24,25) |
| InChIKey | RWORTODUUMJEPA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|