C16H15N5O2 — CID 19147057
6-(4-methoxyphenoxy)-4-N-pyridin-2-ylpyrimidine-4,5-diamine (PubChem CID 19147057) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 6-(4-methoxyphenoxy)-4-N-pyridin-2-ylpyrimidine-4,5-diamine.
| Compound Name | 6-(4-methoxyphenoxy)-4-N-pyridin-2-ylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19147057 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 6-(4-methoxyphenoxy)-4-N-pyridin-2-ylpyrimidine-4,5-diamine |
| SMILES | COc1ccc(Oc2ncnc(Nc3ccccn3)c2N)cc1 |
| InChI | InChI=1S/C16H15N5O2/c1-22-11-5-7-12(8-6-11)23-16-14(17)15(19-10-20-16)21-13-4-2-3-9-18-13/h2-10H,17H2,1H3,(H,18,19,20,21) |
| InChIKey | LPHVXGGPUVZDDN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |