C15H14N6 — CID 19146951
6-N-phenyl-4-N-pyridin-2-ylpyrimidine-4,5,6-triamine (PubChem CID 19146951) has the molecular formula C15H14N6 and a molecular weight of 278.32 g/mol. Its IUPAC name is 6-N-phenyl-4-N-pyridin-2-ylpyrimidine-4,5,6-triamine.
| Compound Name | 6-N-phenyl-4-N-pyridin-2-ylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19146951 |
| Molecular Formula | C15H14N6 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 6-N-phenyl-4-N-pyridin-2-ylpyrimidine-4,5,6-triamine |
| SMILES | Nc1c(Nc2ccccc2)ncnc1Nc1ccccn1 |
| InChI | InChI=1S/C15H14N6/c16-13-14(20-11-6-2-1-3-7-11)18-10-19-15(13)21-12-8-4-5-9-17-12/h1-10H,16H2,(H2,17,18,19,20,21) |
| InChIKey | IVNNUYGEOSZWCO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |