C22H18N4O2 — CID 19152592
6-phenoxy-4-N-(4-phenoxyphenyl)pyrimidine-4,5-diamine (PubChem CID 19152592) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 6-phenoxy-4-N-(4-phenoxyphenyl)pyrimidine-4,5-diamine.
| Compound Name | 6-phenoxy-4-N-(4-phenoxyphenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19152592 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 6-phenoxy-4-N-(4-phenoxyphenyl)pyrimidine-4,5-diamine |
| SMILES | Nc1c(Nc2ccc(Oc3ccccc3)cc2)ncnc1Oc1ccccc1 |
| InChI | InChI=1S/C22H18N4O2/c23-20-21(24-15-25-22(20)28-18-9-5-2-6-10-18)26-16-11-13-19(14-12-16)27-17-7-3-1-4-8-17/h1-15H,23H2,(H,24,25,26) |
| InChIKey | FUFUCPUZGXYDLH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |