C20H23N5O — CID 19136861
4-N,4-N-diethyl-6-N-(4-phenoxyphenyl)pyrimidine-4,5,6-triamine (PubChem CID 19136861) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 4-N,4-N-diethyl-6-N-(4-phenoxyphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N,4-N-diethyl-6-N-(4-phenoxyphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19136861 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 4-N,4-N-diethyl-6-N-(4-phenoxyphenyl)pyrimidine-4,5,6-triamine |
| SMILES | CCN(CC)c1ncnc(Nc2ccc(Oc3ccccc3)cc2)c1N |
| InChI | InChI=1S/C20H23N5O/c1-3-25(4-2)20-18(21)19(22-14-23-20)24-15-10-12-17(13-11-15)26-16-8-6-5-7-9-16/h5-14H,3-4,21H2,1-2H3,(H,22,23,24) |
| InChIKey | IZVLEDIVFHZLHS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |