C27H29N5O2 — CID 141395582
4-N,4-N-dibenzyl-6-N-[4-(2-methoxyethoxy)phenyl]pyrimidine-4,5,6-triamine (PubChem CID 141395582) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is 4-N,4-N-dibenzyl-6-N-[4-(2-methoxyethoxy)phenyl]pyrimidine-4,5,6-triamine.
| Compound Name | 4-N,4-N-dibenzyl-6-N-[4-(2-methoxyethoxy)phenyl]pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 141395582 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 4-N,4-N-dibenzyl-6-N-[4-(2-methoxyethoxy)phenyl]pyrimidine-4,5,6-triamine |
| SMILES | COCCOc1ccc(Nc2ncnc(N(Cc3ccccc3)Cc3ccccc3)c2N)cc1 |
| InChI | InChI=1S/C27H29N5O2/c1-33-16-17-34-24-14-12-23(13-15-24)31-26-25(28)27(30-20-29-26)32(18-21-8-4-2-5-9-21)19-22-10-6-3-7-11-22/h2-15,20H,16-19,28H2,1H3,(H,29,30,31) |
| InChIKey | BNGXPFCXAALKDR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|