C24H21ClFN5 — CID 19136455
4-N,4-N-dibenzyl-6-N-(3-chloro-4-fluorophenyl)pyrimidine-4,5,6-triamine (PubChem CID 19136455) has the molecular formula C24H21ClFN5 and a molecular weight of 433.92 g/mol. Its IUPAC name is 4-N,4-N-dibenzyl-6-N-(3-chloro-4-fluorophenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N,4-N-dibenzyl-6-N-(3-chloro-4-fluorophenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19136455 |
| Molecular Formula | C24H21ClFN5 |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 4-N,4-N-dibenzyl-6-N-(3-chloro-4-fluorophenyl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(Nc2ccc(F)c(Cl)c2)ncnc1N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H21ClFN5/c25-20-13-19(11-12-21(20)26)30-23-22(27)24(29-16-28-23)31(14-17-7-3-1-4-8-17)15-18-9-5-2-6-10-18/h1-13,16H,14-15,27H2,(H,28,29,30) |
| InChIKey | WKQCUXYYGHCOCC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |