C27H29N5 — CID 22547775
4-N,4-N-dibenzyl-6-N-(4-propan-2-ylphenyl)pyrimidine-4,5,6-triamine (PubChem CID 22547775) has the molecular formula C27H29N5 and a molecular weight of 423.56 g/mol. Its IUPAC name is 4-N,4-N-dibenzyl-6-N-(4-propan-2-ylphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N,4-N-dibenzyl-6-N-(4-propan-2-ylphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22547775 |
| Molecular Formula | C27H29N5 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 4-N,4-N-dibenzyl-6-N-(4-propan-2-ylphenyl)pyrimidine-4,5,6-triamine |
| SMILES | CC(C)c1ccc(Nc2ncnc(N(Cc3ccccc3)Cc3ccccc3)c2N)cc1 |
| InChI | InChI=1S/C27H29N5/c1-20(2)23-13-15-24(16-14-23)31-26-25(28)27(30-19-29-26)32(17-21-9-5-3-6-10-21)18-22-11-7-4-8-12-22/h3-16,19-20H,17-18,28H2,1-2H3,(H,29,30,31) |
| InChIKey | GDSHAOQJANKQCD-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |