C18H26N6O3 — CID 19141681
N-[4-[[5-amino-6-[bis(2-methoxyethyl)amino]pyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 19141681) has the molecular formula C18H26N6O3 and a molecular weight of 374.45 g/mol. Its IUPAC name is N-[4-[[5-amino-6-[bis(2-methoxyethyl)amino]pyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[5-amino-6-[bis(2-methoxyethyl)amino]pyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 19141681 |
| Molecular Formula | C18H26N6O3 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | N-[4-[[5-amino-6-[bis(2-methoxyethyl)amino]pyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | COCCN(CCOC)c1ncnc(Nc2ccc(NC(C)=O)cc2)c1N |
| InChI | InChI=1S/C18H26N6O3/c1-13(25)22-14-4-6-15(7-5-14)23-17-16(19)18(21-12-20-17)24(8-10-26-2)9-11-27-3/h4-7,12H,8-11,19H2,1-3H3,(H,22,25)(H,20,21,23) |
| InChIKey | FCPFYBWAESXEMK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |