C18H24N6O5 — CID 23493727
N-[4-[[6-[bis(2-methoxyethyl)amino]-5-nitropyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 23493727) has the molecular formula C18H24N6O5 and a molecular weight of 404.43 g/mol. Its IUPAC name is N-[4-[[6-[bis(2-methoxyethyl)amino]-5-nitropyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[6-[bis(2-methoxyethyl)amino]-5-nitropyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 23493727 |
| Molecular Formula | C18H24N6O5 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-[4-[[6-[bis(2-methoxyethyl)amino]-5-nitropyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | COCCN(CCOC)c1ncnc(Nc2ccc(NC(C)=O)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H24N6O5/c1-13(25)21-14-4-6-15(7-5-14)22-17-16(24(26)27)18(20-12-19-17)23(8-10-28-2)9-11-29-3/h4-7,12H,8-11H2,1-3H3,(H,21,25)(H,19,20,22) |
| InChIKey | GDOWENLEAFWICO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|