C18H33N5O4 — CID 23492928
6-N,6-N-bis(2-methoxyethyl)-4-N,4-N-bis(2-methylpropyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23492928) has the molecular formula C18H33N5O4 and a molecular weight of 383.49 g/mol. Its IUPAC name is 6-N,6-N-bis(2-methoxyethyl)-4-N,4-N-bis(2-methylpropyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N,6-N-bis(2-methoxyethyl)-4-N,4-N-bis(2-methylpropyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23492928 |
| Molecular Formula | C18H33N5O4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | 6-N,6-N-bis(2-methoxyethyl)-4-N,4-N-bis(2-methylpropyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | COCCN(CCOC)c1ncnc(N(CC(C)C)CC(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H33N5O4/c1-14(2)11-22(12-15(3)4)18-16(23(24)25)17(19-13-20-18)21(7-9-26-5)8-10-27-6/h13-15H,7-12H2,1-6H3 |
| InChIKey | NPEKNPJCAVHBRV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 93.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|