C14H23ClN4O2 — CID 107870670
6-chloro-N,N-bis(3-methylbutyl)-5-nitropyrimidin-4-amine (PubChem CID 107870670) has the molecular formula C14H23ClN4O2 and a molecular weight of 314.82 g/mol. Its IUPAC name is 6-chloro-N,N-bis(3-methylbutyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-chloro-N,N-bis(3-methylbutyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 107870670 |
| Molecular Formula | C14H23ClN4O2 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 6-chloro-N,N-bis(3-methylbutyl)-5-nitropyrimidin-4-amine |
| SMILES | CC(C)CCN(CCC(C)C)c1ncnc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H23ClN4O2/c1-10(2)5-7-18(8-6-11(3)4)14-12(19(20)21)13(15)16-9-17-14/h9-11H,5-8H2,1-4H3 |
| InChIKey | PNKYZPXUJASDHV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 72.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|