C17H31N5O2 — CID 23491699
6-N-butyl-6-N-methyl-4-N,4-N-bis(2-methylpropyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23491699) has the molecular formula C17H31N5O2 and a molecular weight of 337.47 g/mol. Its IUPAC name is 6-N-butyl-6-N-methyl-4-N,4-N-bis(2-methylpropyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-butyl-6-N-methyl-4-N,4-N-bis(2-methylpropyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23491699 |
| Molecular Formula | C17H31N5O2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.25 |
| IUPAC Name | 6-N-butyl-6-N-methyl-4-N,4-N-bis(2-methylpropyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | CCCCN(C)c1ncnc(N(CC(C)C)CC(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H31N5O2/c1-7-8-9-20(6)16-15(22(23)24)17(19-12-18-16)21(10-13(2)3)11-14(4)5/h12-14H,7-11H2,1-6H3 |
| InChIKey | MICIGAAWTSUOHK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|