C17H30N6O4 — CID 23493746
4-N,4-N-bis(2-methoxyethyl)-6-N-methyl-6-N-(1-methylpiperidin-4-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23493746) has the molecular formula C17H30N6O4 and a molecular weight of 382.47 g/mol. Its IUPAC name is 4-N,4-N-bis(2-methoxyethyl)-6-N-methyl-6-N-(1-methylpiperidin-4-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N,4-N-bis(2-methoxyethyl)-6-N-methyl-6-N-(1-methylpiperidin-4-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23493746 |
| Molecular Formula | C17H30N6O4 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 4-N,4-N-bis(2-methoxyethyl)-6-N-methyl-6-N-(1-methylpiperidin-4-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | COCCN(CCOC)c1ncnc(N(C)C2CCN(C)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H30N6O4/c1-20-7-5-14(6-8-20)21(2)16-15(23(24)25)17(19-13-18-16)22(9-11-26-3)10-12-27-4/h13-14H,5-12H2,1-4H3 |
| InChIKey | RUMKMCWJFWSRJX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 97.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|