C19H25N7O3 — CID 22538130
N-[4-[[6-[methyl-(1-methylpiperidin-4-yl)amino]-5-nitropyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 22538130) has the molecular formula C19H25N7O3 and a molecular weight of 399.46 g/mol. Its IUPAC name is N-[4-[[6-[methyl-(1-methylpiperidin-4-yl)amino]-5-nitropyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[6-[methyl-(1-methylpiperidin-4-yl)amino]-5-nitropyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 22538130 |
| Molecular Formula | C19H25N7O3 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | N-[4-[[6-[methyl-(1-methylpiperidin-4-yl)amino]-5-nitropyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2ncnc(N(C)C3CCN(C)CC3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H25N7O3/c1-13(27)22-14-4-6-15(7-5-14)23-18-17(26(28)29)19(21-12-20-18)25(3)16-8-10-24(2)11-9-16/h4-7,12,16H,8-11H2,1-3H3,(H,22,27)(H,20,21,23) |
| InChIKey | LERHXMCCKDEIAU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|