C17H20F2N6O2 — CID 22538671
6-N-(2,4-difluorophenyl)-4-N-methyl-4-N-(1-methylpiperidin-4-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22538671) has the molecular formula C17H20F2N6O2 and a molecular weight of 378.38 g/mol. Its IUPAC name is 6-N-(2,4-difluorophenyl)-4-N-methyl-4-N-(1-methylpiperidin-4-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(2,4-difluorophenyl)-4-N-methyl-4-N-(1-methylpiperidin-4-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22538671 |
| Molecular Formula | C17H20F2N6O2 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 6-N-(2,4-difluorophenyl)-4-N-methyl-4-N-(1-methylpiperidin-4-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | CN1CCC(N(C)c2ncnc(Nc3ccc(F)cc3F)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H20F2N6O2/c1-23-7-5-12(6-8-23)24(2)17-15(25(26)27)16(20-10-21-17)22-14-4-3-11(18)9-13(14)19/h3-4,9-10,12H,5-8H2,1-2H3,(H,20,21,22) |
| InChIKey | UMQBPEBKRNLYAV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|