C19H23N7O2S — CID 22534484
4-N-methyl-6-N-(6-methyl-1,3-benzothiazol-2-yl)-4-N-(1-methylpiperidin-4-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22534484) has the molecular formula C19H23N7O2S and a molecular weight of 413.51 g/mol. Its IUPAC name is 4-N-methyl-6-N-(6-methyl-1,3-benzothiazol-2-yl)-4-N-(1-methylpiperidin-4-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-methyl-6-N-(6-methyl-1,3-benzothiazol-2-yl)-4-N-(1-methylpiperidin-4-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22534484 |
| Molecular Formula | C19H23N7O2S |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 4-N-methyl-6-N-(6-methyl-1,3-benzothiazol-2-yl)-4-N-(1-methylpiperidin-4-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | Cc1ccc2nc(Nc3ncnc(N(C)C4CCN(C)CC4)c3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C19H23N7O2S/c1-12-4-5-14-15(10-12)29-19(22-14)23-17-16(26(27)28)18(21-11-20-17)25(3)13-6-8-24(2)9-7-13/h4-5,10-11,13H,6-9H2,1-3H3,(H,20,21,22,23) |
| InChIKey | PRWXKPWEDQQRSG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|