C22H24N6O2S — CID 22525762
4-N-(1-adamantyl)-6-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22525762) has the molecular formula C22H24N6O2S and a molecular weight of 436.54 g/mol. Its IUPAC name is 4-N-(1-adamantyl)-6-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(1-adamantyl)-6-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22525762 |
| Molecular Formula | C22H24N6O2S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 4-N-(1-adamantyl)-6-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | Cc1ccc2nc(Nc3ncnc(NC45CC6CC(CC(C6)C4)C5)c3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C22H24N6O2S/c1-12-2-3-16-17(4-12)31-21(25-16)26-19-18(28(29)30)20(24-11-23-19)27-22-8-13-5-14(9-22)7-15(6-13)10-22/h2-4,11,13-15H,5-10H2,1H3,(H2,23,24,25,26,27) |
| InChIKey | HNBQMWSFQMUFDA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|