C21H19N5O3S — CID 23490699
6-methyl-N-[5-nitro-6-(4-propan-2-ylphenoxy)pyrimidin-4-yl]-1,3-benzothiazol-2-amine (PubChem CID 23490699) has the molecular formula C21H19N5O3S and a molecular weight of 421.48 g/mol. Its IUPAC name is 6-methyl-N-[5-nitro-6-(4-propan-2-ylphenoxy)pyrimidin-4-yl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-methyl-N-[5-nitro-6-(4-propan-2-ylphenoxy)pyrimidin-4-yl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 23490699 |
| Molecular Formula | C21H19N5O3S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 6-methyl-N-[5-nitro-6-(4-propan-2-ylphenoxy)pyrimidin-4-yl]-1,3-benzothiazol-2-amine |
| SMILES | Cc1ccc2nc(Nc3ncnc(Oc4ccc(C(C)C)cc4)c3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C21H19N5O3S/c1-12(2)14-5-7-15(8-6-14)29-20-18(26(27)28)19(22-11-23-20)25-21-24-16-9-4-13(3)10-17(16)30-21/h4-12H,1-3H3,(H,22,23,24,25) |
| InChIKey | NXRDHYYUMVBHPD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|