C19H14ClN5O3S — CID 22534365
N-[6-(4-chloro-3-methylphenoxy)-5-nitropyrimidin-4-yl]-4-methyl-1,3-benzothiazol-2-amine (PubChem CID 22534365) has the molecular formula C19H14ClN5O3S and a molecular weight of 427.87 g/mol. Its IUPAC name is N-[6-(4-chloro-3-methylphenoxy)-5-nitropyrimidin-4-yl]-4-methyl-1,3-benzothiazol-2-amine.
| Compound Name | N-[6-(4-chloro-3-methylphenoxy)-5-nitropyrimidin-4-yl]-4-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 22534365 |
| Molecular Formula | C19H14ClN5O3S |
| Molecular Weight | 427.87 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | N-[6-(4-chloro-3-methylphenoxy)-5-nitropyrimidin-4-yl]-4-methyl-1,3-benzothiazol-2-amine |
| SMILES | Cc1cc(Oc2ncnc(Nc3nc4c(C)cccc4s3)c2[N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C19H14ClN5O3S/c1-10-4-3-5-14-15(10)23-19(29-14)24-17-16(25(26)27)18(22-9-21-17)28-12-6-7-13(20)11(2)8-12/h3-9H,1-2H3,(H,21,22,23,24) |
| InChIKey | NGNSPVFGYAOGBH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.87 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|