C22H20ClN7O2S — CID 23491059
N-[6-[4-(3-chlorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-4-methyl-1,3-benzothiazol-2-amine (PubChem CID 23491059) has the molecular formula C22H20ClN7O2S and a molecular weight of 481.97 g/mol. Its IUPAC name is N-[6-[4-(3-chlorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-4-methyl-1,3-benzothiazol-2-amine.
| Compound Name | N-[6-[4-(3-chlorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-4-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 23491059 |
| Molecular Formula | C22H20ClN7O2S |
| Molecular Weight | 481.97 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | N-[6-[4-(3-chlorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-4-methyl-1,3-benzothiazol-2-amine |
| SMILES | Cc1cccc2sc(Nc3ncnc(N4CCN(c5cccc(Cl)c5)CC4)c3[N+](=O)[O-])nc12 |
| InChI | InChI=1S/C22H20ClN7O2S/c1-14-4-2-7-17-18(14)26-22(33-17)27-20-19(30(31)32)21(25-13-24-20)29-10-8-28(9-11-29)16-6-3-5-15(23)12-16/h2-7,12-13H,8-11H2,1H3,(H,24,25,26,27) |
| InChIKey | HMMWFDXTKKOCCD-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.97 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|