C20H19ClN8O4 — CID 23491009
1-[6-[4-(3-chlorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-2-(4-nitrophenyl)hydrazine (PubChem CID 23491009) has the molecular formula C20H19ClN8O4 and a molecular weight of 470.88 g/mol. Its IUPAC name is 1-[6-[4-(3-chlorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-2-(4-nitrophenyl)hydrazine.
| Compound Name | 1-[6-[4-(3-chlorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-2-(4-nitrophenyl)hydrazine |
|---|---|
| PubChem CID | 23491009 |
| Molecular Formula | C20H19ClN8O4 |
| Molecular Weight | 470.88 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 1-[6-[4-(3-chlorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-2-(4-nitrophenyl)hydrazine |
| SMILES | O=[N+]([O-])c1ccc(NNc2ncnc(N3CCN(c4cccc(Cl)c4)CC3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H19ClN8O4/c21-14-2-1-3-17(12-14)26-8-10-27(11-9-26)20-18(29(32)33)19(22-13-23-20)25-24-15-4-6-16(7-5-15)28(30)31/h1-7,12-13,24H,8-11H2,(H,22,23,25) |
| InChIKey | SBJNLUKKKDCGQS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 142.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.88 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|