C21H20ClFN6O2 — CID 23491122
6-[4-(3-chlorophenyl)piperazin-1-yl]-N-[(4-fluorophenyl)methyl]-5-nitropyrimidin-4-amine (PubChem CID 23491122) has the molecular formula C21H20ClFN6O2 and a molecular weight of 442.88 g/mol. Its IUPAC name is 6-[4-(3-chlorophenyl)piperazin-1-yl]-N-[(4-fluorophenyl)methyl]-5-nitropyrimidin-4-amine.
| Compound Name | 6-[4-(3-chlorophenyl)piperazin-1-yl]-N-[(4-fluorophenyl)methyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23491122 |
| Molecular Formula | C21H20ClFN6O2 |
| Molecular Weight | 442.88 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 6-[4-(3-chlorophenyl)piperazin-1-yl]-N-[(4-fluorophenyl)methyl]-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCc2ccc(F)cc2)ncnc1N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C21H20ClFN6O2/c22-16-2-1-3-18(12-16)27-8-10-28(11-9-27)21-19(29(30)31)20(25-14-26-21)24-13-15-4-6-17(23)7-5-15/h1-7,12,14H,8-11,13H2,(H,24,25,26) |
| InChIKey | MRWMQYAUEWFJNJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.88 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|