C22H23FN6O3 — CID 23490942
N-[(4-fluorophenyl)methyl]-6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine (PubChem CID 23490942) has the molecular formula C22H23FN6O3 and a molecular weight of 438.46 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine.
| Compound Name | N-[(4-fluorophenyl)methyl]-6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23490942 |
| Molecular Formula | C22H23FN6O3 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine |
| SMILES | COc1ccc(N2CCN(c3ncnc(NCc4ccc(F)cc4)c3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C22H23FN6O3/c1-32-19-8-6-18(7-9-19)27-10-12-28(13-11-27)22-20(29(30)31)21(25-15-26-22)24-14-16-2-4-17(23)5-3-16/h2-9,15H,10-14H2,1H3,(H,24,25,26) |
| InChIKey | QNGDMWGAZVLWML-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|