C21H22N6O3 — CID 23490857
6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitro-N-phenylpyrimidin-4-amine (PubChem CID 23490857) has the molecular formula C21H22N6O3 and a molecular weight of 406.45 g/mol. Its IUPAC name is 6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitro-N-phenylpyrimidin-4-amine.
| Compound Name | 6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitro-N-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 23490857 |
| Molecular Formula | C21H22N6O3 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitro-N-phenylpyrimidin-4-amine |
| SMILES | COc1ccc(N2CCN(c3ncnc(Nc4ccccc4)c3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C21H22N6O3/c1-30-18-9-7-17(8-10-18)25-11-13-26(14-12-25)21-19(27(28)29)20(22-15-23-21)24-16-5-3-2-4-6-16/h2-10,15H,11-14H2,1H3,(H,22,23,24) |
| InChIKey | HQOLJFDMWDIVTA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|