C22H24N6O3 — CID 23490858
6-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(2-methylphenyl)-5-nitropyrimidin-4-amine (PubChem CID 23490858) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is 6-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(2-methylphenyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(2-methylphenyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23490858 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 6-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(2-methylphenyl)-5-nitropyrimidin-4-amine |
| SMILES | COc1ccc(N2CCN(c3ncnc(Nc4ccccc4C)c3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C22H24N6O3/c1-16-5-3-4-6-19(16)25-21-20(28(29)30)22(24-15-23-21)27-13-11-26(12-14-27)17-7-9-18(31-2)10-8-17/h3-10,15H,11-14H2,1-2H3,(H,23,24,25) |
| InChIKey | RBWJMKVLVZIBAX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|