C20H23N7O3S — CID 23490876
N-[6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-4,5-dimethyl-1,3-thiazol-2-amine (PubChem CID 23490876) has the molecular formula C20H23N7O3S and a molecular weight of 441.52 g/mol. Its IUPAC name is N-[6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-4,5-dimethyl-1,3-thiazol-2-amine.
| Compound Name | N-[6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-4,5-dimethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 23490876 |
| Molecular Formula | C20H23N7O3S |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | N-[6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-4,5-dimethyl-1,3-thiazol-2-amine |
| SMILES | COc1ccc(N2CCN(c3ncnc(Nc4nc(C)c(C)s4)c3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C20H23N7O3S/c1-13-14(2)31-20(23-13)24-18-17(27(28)29)19(22-12-21-18)26-10-8-25(9-11-26)15-4-6-16(30-3)7-5-15/h4-7,12H,8-11H2,1-3H3,(H,21,22,23,24) |
| InChIKey | VWZWPONBQLGPBJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 109.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|