C19H20FN7O2S — CID 22533974
N-[6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-4,5-dimethyl-1,3-thiazol-2-amine (PubChem CID 22533974) has the molecular formula C19H20FN7O2S and a molecular weight of 429.48 g/mol. Its IUPAC name is N-[6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-4,5-dimethyl-1,3-thiazol-2-amine.
| Compound Name | N-[6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-4,5-dimethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 22533974 |
| Molecular Formula | C19H20FN7O2S |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-[6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-4,5-dimethyl-1,3-thiazol-2-amine |
| SMILES | Cc1nc(Nc2ncnc(N3CCN(c4ccccc4F)CC3)c2[N+](=O)[O-])sc1C |
| InChI | InChI=1S/C19H20FN7O2S/c1-12-13(2)30-19(23-12)24-17-16(27(28)29)18(22-11-21-17)26-9-7-25(8-10-26)15-6-4-3-5-14(15)20/h3-6,11H,7-10H2,1-2H3,(H,21,22,23,24) |
| InChIKey | WEUQQXPEGIYTSZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|